About (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one
(3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one (PubChem CID 23138869) has the molecular formula C28H24N2O2
and a molecular weight of 420.51 g/mol. Its IUPAC name is (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one.
Molecular Properties
| Compound Name | (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one |
| PubChem CID | 23138869 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one |
| SMILES | O=C1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C/C1=C\c1ccno1 |
| InChI | InChI=1S/C28H24N2O2/c31-27-17-19-30(21-22(27)20-26-16-18-29-32-26)28(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-16,18,20H,17,19,21H2/b22-20+ |
| InChIKey | NSNHOHDRWXXSPK-LSDHQDQOSA-N |
| XLogP | 5.32 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one?
The IUPAC name of (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one (CID 23138869) is (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one.
What is the SMILES notation for (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one?
The canonical SMILES for (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one is O=C1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C/C1=C\c1ccno1.
What is the InChIKey of (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one?
The InChIKey is NSNHOHDRWXXSPK-LSDHQDQOSA-N. The full InChI is InChI=1S/C28H24N2O2/c31-27-17-19-30(21-22(27)20-26-16-18-29-32-26)28(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-16,18,20H,17,19,21H2/b22-20+.
What are the key properties of (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one?
(3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one has a molecular weight of 420.51 g/mol, XLogP of 5.32, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(1,2-oxazol-5-ylmethylidene)-1-tritylpiperidin-4-one is sourced from PubChem (CID 23138869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).