C23H29N3O — CID 23140585
3-(4-benzylpiperidin-1-yl)-N-(2-methylphenyl)azetidine-1-carboxamide (PubChem CID 23140585) has the molecular formula C23H29N3O and a molecular weight of 363.50 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-N-(2-methylphenyl)azetidine-1-carboxamide.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-N-(2-methylphenyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 23140585 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-N-(2-methylphenyl)azetidine-1-carboxamide |
| SMILES | Cc1ccccc1NC(=O)N1CC(N2CCC(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C23H29N3O/c1-18-7-5-6-10-22(18)24-23(27)26-16-21(17-26)25-13-11-20(12-14-25)15-19-8-3-2-4-9-19/h2-10,20-21H,11-17H2,1H3,(H,24,27) |
| InChIKey | NEXHOZVYABTDFH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |