About 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide
2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide (PubChem CID 2314061) has the molecular formula C16H14N2O4S
and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide |
| PubChem CID | 2314061 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide |
| SMILES | O=C(NCc1ccco1)c1ccc(C(=O)NCc2ccco2)s1 |
| InChI | InChI=1S/C16H14N2O4S/c19-15(17-9-11-3-1-7-21-11)13-5-6-14(23-13)16(20)18-10-12-4-2-8-22-12/h1-8H,9-10H2,(H,17,19)(H,18,20) |
| InChIKey | BAUSLVZPMPHTHQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide?
The IUPAC name of 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide (CID 2314061) is 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide.
What is the SMILES notation for 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide?
The canonical SMILES for 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide is O=C(NCc1ccco1)c1ccc(C(=O)NCc2ccco2)s1.
What is the InChIKey of 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide?
The InChIKey is BAUSLVZPMPHTHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4S/c19-15(17-9-11-3-1-7-21-11)13-5-6-14(23-13)16(20)18-10-12-4-2-8-22-12/h1-8H,9-10H2,(H,17,19)(H,18,20).
What are the key properties of 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide?
2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide has a molecular weight of 330.36 g/mol, XLogP of 2.79, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,5-N-bis(furan-2-ylmethyl)thiophene-2,5-dicarboxamide is sourced from PubChem (CID 2314061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).