C53H46N2O4 — CID 23140846
N,N'-bis(2-hydroxy-1-naphthalen-2-yl-2,2-diphenylethyl)-2,2-dimethylpropanediamide (PubChem CID 23140846) has the molecular formula C53H46N2O4 and a molecular weight of 774.96 g/mol. Its IUPAC name is N,N'-bis(2-hydroxy-1-naphthalen-2-yl-2,2-diphenylethyl)-2,2-dimethylpropanediamide.
| Compound Name | N,N'-bis(2-hydroxy-1-naphthalen-2-yl-2,2-diphenylethyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 23140846 |
| Molecular Formula | C53H46N2O4 |
| Molecular Weight | 774.96 g/mol |
| Exact Mass | 774.35 |
| IUPAC Name | N,N'-bis(2-hydroxy-1-naphthalen-2-yl-2,2-diphenylethyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)NC(c1ccc2ccccc2c1)C(O)(c1ccccc1)c1ccccc1)C(=O)NC(c1ccc2ccccc2c1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C53H46N2O4/c1-51(2,49(56)54-47(41-33-31-37-19-15-17-21-39(37)35-41)52(58,43-23-7-3-8-24-43)44-25-9-4-10-26-44)50(57)55-48(42-34-32-38-20-16-18-22-40(38)36-42)53(59,45-27-11-5-12-28-45)46-29-13-6-14-30-46/h3-36,47-48,58-59H,1-2H3,(H,54,56)(H,55,57) |
| InChIKey | VHYLSJMDRLOJBJ-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.96 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|