C11H22N2O4 — CID 23140861
N,N'-bis(1-hydroxypropan-2-yl)-2,2-dimethylpropanediamide (PubChem CID 23140861) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is N,N'-bis(1-hydroxypropan-2-yl)-2,2-dimethylpropanediamide.
| Compound Name | N,N'-bis(1-hydroxypropan-2-yl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 23140861 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N,N'-bis(1-hydroxypropan-2-yl)-2,2-dimethylpropanediamide |
| SMILES | CC(CO)NC(=O)C(C)(C)C(=O)NC(C)CO |
| InChI | InChI=1S/C11H22N2O4/c1-7(5-14)12-9(16)11(3,4)10(17)13-8(2)6-15/h7-8,14-15H,5-6H2,1-4H3,(H,12,16)(H,13,17) |
| InChIKey | CGLZQRUHDKWBKR-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|