C44H40N2O4 — CID 23140884
N,N'-bis(1-hydroxy-1,1,3-triphenylpropan-2-yl)oxamide (PubChem CID 23140884) has the molecular formula C44H40N2O4 and a molecular weight of 660.81 g/mol. Its IUPAC name is N,N'-bis(1-hydroxy-1,1,3-triphenylpropan-2-yl)oxamide.
| Compound Name | N,N'-bis(1-hydroxy-1,1,3-triphenylpropan-2-yl)oxamide |
|---|---|
| PubChem CID | 23140884 |
| Molecular Formula | C44H40N2O4 |
| Molecular Weight | 660.81 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | N,N'-bis(1-hydroxy-1,1,3-triphenylpropan-2-yl)oxamide |
| SMILES | O=C(NC(Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1)C(=O)NC(Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H40N2O4/c47-41(45-39(31-33-19-7-1-8-20-33)43(49,35-23-11-3-12-24-35)36-25-13-4-14-26-36)42(48)46-40(32-34-21-9-2-10-22-34)44(50,37-27-15-5-16-28-37)38-29-17-6-18-30-38/h1-30,39-40,49-50H,31-32H2,(H,45,47)(H,46,48) |
| InChIKey | CQJIXNNKXYIDCU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.81 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|