C17H30N2O4 — CID 23140960
N,N'-bis[1-(1-hydroxycyclobutyl)ethyl]-2,2-dimethylpropanediamide (PubChem CID 23140960) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is N,N'-bis[1-(1-hydroxycyclobutyl)ethyl]-2,2-dimethylpropanediamide.
| Compound Name | N,N'-bis[1-(1-hydroxycyclobutyl)ethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 23140960 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | N,N'-bis[1-(1-hydroxycyclobutyl)ethyl]-2,2-dimethylpropanediamide |
| SMILES | CC(NC(=O)C(C)(C)C(=O)NC(C)C1(O)CCC1)C1(O)CCC1 |
| InChI | InChI=1S/C17H30N2O4/c1-11(16(22)7-5-8-16)18-13(20)15(3,4)14(21)19-12(2)17(23)9-6-10-17/h11-12,22-23H,5-10H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | IONMJZKDSZJISY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|