C15H30N2O4 — CID 23140985
N,N'-bis(1-hydroxy-3-methylbutan-2-yl)-2,2-dimethylpropanediamide (PubChem CID 23140985) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is N,N'-bis(1-hydroxy-3-methylbutan-2-yl)-2,2-dimethylpropanediamide.
| Compound Name | N,N'-bis(1-hydroxy-3-methylbutan-2-yl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 23140985 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | N,N'-bis(1-hydroxy-3-methylbutan-2-yl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)C(CO)NC(=O)C(C)(C)C(=O)NC(CO)C(C)C |
| InChI | InChI=1S/C15H30N2O4/c1-9(2)11(7-18)16-13(20)15(5,6)14(21)17-12(8-19)10(3)4/h9-12,18-19H,7-8H2,1-6H3,(H,16,20)(H,17,21) |
| InChIKey | WYAFXHCGVCNSMG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|