C20H36N2O4 — CID 23141022
N,N'-bis[1-(1-hydroxycyclobutyl)-2,2-dimethylpropyl]oxamide (PubChem CID 23141022) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is N,N'-bis[1-(1-hydroxycyclobutyl)-2,2-dimethylpropyl]oxamide.
| Compound Name | N,N'-bis[1-(1-hydroxycyclobutyl)-2,2-dimethylpropyl]oxamide |
|---|---|
| PubChem CID | 23141022 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | N,N'-bis[1-(1-hydroxycyclobutyl)-2,2-dimethylpropyl]oxamide |
| SMILES | CC(C)(C)C(NC(=O)C(=O)NC(C(C)(C)C)C1(O)CCC1)C1(O)CCC1 |
| InChI | InChI=1S/C20H36N2O4/c1-17(2,3)15(19(25)9-7-10-19)21-13(23)14(24)22-16(18(4,5)6)20(26)11-8-12-20/h15-16,25-26H,7-12H2,1-6H3,(H,21,23)(H,22,24) |
| InChIKey | OCPXGWUYMFGJSC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|