C9H18N2O4 — CID 23141053
N,N'-bis(1-hydroxypropan-2-yl)propanediamide (PubChem CID 23141053) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is N,N'-bis(1-hydroxypropan-2-yl)propanediamide.
| Compound Name | N,N'-bis(1-hydroxypropan-2-yl)propanediamide |
|---|---|
| PubChem CID | 23141053 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | N,N'-bis(1-hydroxypropan-2-yl)propanediamide |
| SMILES | CC(CO)NC(=O)CC(=O)NC(C)CO |
| InChI | InChI=1S/C9H18N2O4/c1-6(4-12)10-8(14)3-9(15)11-7(2)5-13/h6-7,12-13H,3-5H2,1-2H3,(H,10,14)(H,11,15) |
| InChIKey | VXYZIOROFFDXJM-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|