C28H45ClF3N3O — CID 23141574
4-[3-(4-tert-butylcyclohexyl)-4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]morpholine;hydrochloride (PubChem CID 23141574) has the molecular formula C28H45ClF3N3O and a molecular weight of 532.14 g/mol. Its IUPAC name is 4-[3-(4-tert-butylcyclohexyl)-4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]morpholine;hydrochloride.
| Compound Name | 4-[3-(4-tert-butylcyclohexyl)-4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 23141574 |
| Molecular Formula | C28H45ClF3N3O |
| Molecular Weight | 532.14 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | 4-[3-(4-tert-butylcyclohexyl)-4-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]phenyl]morpholine;hydrochloride |
| SMILES | CC(C)(C)C1CCC(c2cc(N3CCOCC3)ccc2N2CCN(CCCC(F)(F)F)CC2)CC1.Cl |
| InChI | InChI=1S/C28H44F3N3O.ClH/c1-27(2,3)23-7-5-22(6-8-23)25-21-24(33-17-19-35-20-18-33)9-10-26(25)34-15-13-32(14-16-34)12-4-11-28(29,30)31;/h9-10,21-23H,4-8,11-20H2,1-3H3;1H |
| InChIKey | QCZWBAMJFJMGJQ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.14 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|