C28H45N3O — CID 23142147
2,6-dimethyl-4-[4-[4-(2-methylpropyl)piperazin-1-yl]-3-spiro[2.5]octan-6-ylphenyl]morpholine (PubChem CID 23142147) has the molecular formula C28H45N3O and a molecular weight of 439.69 g/mol. Its IUPAC name is 2,6-dimethyl-4-[4-[4-(2-methylpropyl)piperazin-1-yl]-3-spiro[2.5]octan-6-ylphenyl]morpholine.
| Compound Name | 2,6-dimethyl-4-[4-[4-(2-methylpropyl)piperazin-1-yl]-3-spiro[2.5]octan-6-ylphenyl]morpholine |
|---|---|
| PubChem CID | 23142147 |
| Molecular Formula | C28H45N3O |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.36 |
| IUPAC Name | 2,6-dimethyl-4-[4-[4-(2-methylpropyl)piperazin-1-yl]-3-spiro[2.5]octan-6-ylphenyl]morpholine |
| SMILES | CC(C)CN1CCN(c2ccc(N3CC(C)OC(C)C3)cc2C2CCC3(CC2)CC3)CC1 |
| InChI | InChI=1S/C28H45N3O/c1-21(2)18-29-13-15-30(16-14-29)27-6-5-25(31-19-22(3)32-23(4)20-31)17-26(27)24-7-9-28(10-8-24)11-12-28/h5-6,17,21-24H,7-16,18-20H2,1-4H3 |
| InChIKey | VQUZCFFVGCPWDG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|