C22H32N2O3 — CID 23142555
4-methoxy-1-[4-nitro-3-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]piperidine (PubChem CID 23142555) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 4-methoxy-1-[4-nitro-3-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]piperidine.
| Compound Name | 4-methoxy-1-[4-nitro-3-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 23142555 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 4-methoxy-1-[4-nitro-3-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]piperidine |
| SMILES | COC1CCN(c2ccc([N+](=O)[O-])c(C3=CC(C)(C)CC(C)(C)C3)c2)CC1 |
| InChI | InChI=1S/C22H32N2O3/c1-21(2)13-16(14-22(3,4)15-21)19-12-17(6-7-20(19)24(25)26)23-10-8-18(27-5)9-11-23/h6-7,12-13,18H,8-11,14-15H2,1-5H3 |
| InChIKey | ARPKWUWERPNPTN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|