About 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride
1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride (PubChem CID 23142965) has the molecular formula C26H41ClN2O
and a molecular weight of 433.08 g/mol. Its IUPAC name is 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride |
| PubChem CID | 23142965 |
| Molecular Formula | C26H41ClN2O |
| Molecular Weight | 433.08 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride |
| SMILES | CCC1(CC)CC=C(c2ccccc2N2CCN(CC3CCOCC3)CC2)CC1.Cl |
| InChI | InChI=1S/C26H40N2O.ClH/c1-3-26(4-2)13-9-23(10-14-26)24-7-5-6-8-25(24)28-17-15-27(16-18-28)21-22-11-19-29-20-12-22;/h5-9,22H,3-4,10-21H2,1-2H3;1H |
| InChIKey | LOLNMAXKMQFGSB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.08 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride?
The IUPAC name of 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride (CID 23142965) is 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride.
What is the SMILES notation for 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride?
The canonical SMILES for 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride is CCC1(CC)CC=C(c2ccccc2N2CCN(CC3CCOCC3)CC2)CC1.Cl.
What is the InChIKey of 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride?
The InChIKey is LOLNMAXKMQFGSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H40N2O.ClH/c1-3-26(4-2)13-9-23(10-14-26)24-7-5-6-8-25(24)28-17-15-27(16-18-28)21-22-11-19-29-20-12-22;/h5-9,22H,3-4,10-21H2,1-2H3;1H.
What are the key properties of 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride?
1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride has a molecular weight of 433.08 g/mol, XLogP of 6.03, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4,4-diethylcyclohexen-1-yl)phenyl]-4-(oxan-4-ylmethyl)piperazine;hydrochloride is sourced from PubChem (CID 23142965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).