About (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine
(3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine (PubChem CID 2314319) has the molecular formula C23H26Cl2NOP
and a molecular weight of 434.35 g/mol. Its IUPAC name is (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine.
Molecular Properties
| Compound Name | (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine |
| PubChem CID | 2314319 |
| Molecular Formula | C23H26Cl2NOP |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine |
| SMILES | C[C@@H]1C[C@H](C)CN(P(=O)(/C=C(\Cl)c2ccccc2)/C=C(\Cl)c2ccccc2)C1 |
| InChI | InChI=1S/C23H26Cl2NOP/c1-18-13-19(2)15-26(14-18)28(27,16-22(24)20-9-5-3-6-10-20)17-23(25)21-11-7-4-8-12-21/h3-12,16-19H,13-15H2,1-2H3/b22-16-,23-17-/t18-,19+ |
| InChIKey | WWALZUPRANOMKH-PTYHNJSWSA-N |
| XLogP | 7.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine?
The IUPAC name of (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine (CID 2314319) is (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine.
What is the SMILES notation for (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine?
The canonical SMILES for (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine is C[C@@H]1C[C@H](C)CN(P(=O)(/C=C(\Cl)c2ccccc2)/C=C(\Cl)c2ccccc2)C1.
What is the InChIKey of (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine?
The InChIKey is WWALZUPRANOMKH-PTYHNJSWSA-N. The full InChI is InChI=1S/C23H26Cl2NOP/c1-18-13-19(2)15-26(14-18)28(27,16-22(24)20-9-5-3-6-10-20)17-23(25)21-11-7-4-8-12-21/h3-12,16-19H,13-15H2,1-2H3/b22-16-,23-17-/t18-,19+.
What are the key properties of (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine?
(3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine has a molecular weight of 434.35 g/mol, XLogP of 7.72, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-1-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3,5-dimethylpiperidine is sourced from PubChem (CID 2314319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).