C22H25N5O3 — CID 23143591
methyl 3-[6-[3-(tert-butylcarbamoyl)-1-pyridin-3-ylpyrazol-5-yl]-3-pyridinyl]propanoate (PubChem CID 23143591) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl 3-[6-[3-(tert-butylcarbamoyl)-1-pyridin-3-ylpyrazol-5-yl]-3-pyridinyl]propanoate.
| Compound Name | methyl 3-[6-[3-(tert-butylcarbamoyl)-1-pyridin-3-ylpyrazol-5-yl]-3-pyridinyl]propanoate |
|---|---|
| PubChem CID | 23143591 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | methyl 3-[6-[3-(tert-butylcarbamoyl)-1-pyridin-3-ylpyrazol-5-yl]-3-pyridinyl]propanoate |
| SMILES | COC(=O)CCc1ccc(-c2cc(C(=O)NC(C)(C)C)nn2-c2cccnc2)nc1 |
| InChI | InChI=1S/C22H25N5O3/c1-22(2,3)25-21(29)18-12-19(27(26-18)16-6-5-11-23-14-16)17-9-7-15(13-24-17)8-10-20(28)30-4/h5-7,9,11-14H,8,10H2,1-4H3,(H,25,29) |
| InChIKey | NNXWTTDANAGMKP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |