C22H26N4O4S — CID 23144119
N-[5-butanoyl-4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[2-(dimethylamino)ethoxymethyl]pyridine-4-carboxamide (PubChem CID 23144119) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-[5-butanoyl-4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[2-(dimethylamino)ethoxymethyl]pyridine-4-carboxamide.
| Compound Name | N-[5-butanoyl-4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[2-(dimethylamino)ethoxymethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 23144119 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[5-butanoyl-4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[2-(dimethylamino)ethoxymethyl]pyridine-4-carboxamide |
| SMILES | CCCC(=O)c1sc(NC(=O)c2ccnc(COCCN(C)C)c2)nc1-c1ccco1 |
| InChI | InChI=1S/C22H26N4O4S/c1-4-6-17(27)20-19(18-7-5-11-30-18)24-22(31-20)25-21(28)15-8-9-23-16(13-15)14-29-12-10-26(2)3/h5,7-9,11,13H,4,6,10,12,14H2,1-3H3,(H,24,25,28) |
| InChIKey | OKLYHISFFTXNFZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|