About 5,5-diethoxy-3-oxopentanal
5,5-diethoxy-3-oxopentanal (PubChem CID 23144801) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 5,5-diethoxy-3-oxopentanal.
Molecular Properties
| Compound Name | 5,5-diethoxy-3-oxopentanal |
| PubChem CID | 23144801 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 5,5-diethoxy-3-oxopentanal |
| SMILES | CCOC(CC(=O)CC=O)OCC |
| InChI | InChI=1S/C9H16O4/c1-3-12-9(13-4-2)7-8(11)5-6-10/h6,9H,3-5,7H2,1-2H3 |
| InChIKey | GLWDPRUSIJYECX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5,5-diethoxy-3-oxopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-diethoxy-3-oxopentanal?
The IUPAC name of 5,5-diethoxy-3-oxopentanal (CID 23144801) is 5,5-diethoxy-3-oxopentanal.
What is the SMILES notation for 5,5-diethoxy-3-oxopentanal?
The canonical SMILES for 5,5-diethoxy-3-oxopentanal is CCOC(CC(=O)CC=O)OCC.
What is the InChIKey of 5,5-diethoxy-3-oxopentanal?
The InChIKey is GLWDPRUSIJYECX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-3-12-9(13-4-2)7-8(11)5-6-10/h6,9H,3-5,7H2,1-2H3.
What are the key properties of 5,5-diethoxy-3-oxopentanal?
5,5-diethoxy-3-oxopentanal has a molecular weight of 188.22 g/mol, XLogP of 0.93, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-diethoxy-3-oxopentanal is sourced from PubChem (CID 23144801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).