About (E)-1,5,5-trimethoxypent-1-en-3-one
(E)-1,5,5-trimethoxypent-1-en-3-one (PubChem CID 23144803) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is (E)-1,5,5-trimethoxypent-1-en-3-one.
Molecular Properties
| Compound Name | (E)-1,5,5-trimethoxypent-1-en-3-one |
| PubChem CID | 23144803 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (E)-1,5,5-trimethoxypent-1-en-3-one |
| SMILES | CO/C=C/C(=O)CC(OC)OC |
| InChI | InChI=1S/C8H14O4/c1-10-5-4-7(9)6-8(11-2)12-3/h4-5,8H,6H2,1-3H3/b5-4+ |
| InChIKey | BNGBBSHHXWWVDU-SNAWJCMRSA-N |
| XLogP | 0.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,5,5-trimethoxypent-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,5,5-trimethoxypent-1-en-3-one?
The IUPAC name of (E)-1,5,5-trimethoxypent-1-en-3-one (CID 23144803) is (E)-1,5,5-trimethoxypent-1-en-3-one.
What is the SMILES notation for (E)-1,5,5-trimethoxypent-1-en-3-one?
The canonical SMILES for (E)-1,5,5-trimethoxypent-1-en-3-one is CO/C=C/C(=O)CC(OC)OC.
What is the InChIKey of (E)-1,5,5-trimethoxypent-1-en-3-one?
The InChIKey is BNGBBSHHXWWVDU-SNAWJCMRSA-N. The full InChI is InChI=1S/C8H14O4/c1-10-5-4-7(9)6-8(11-2)12-3/h4-5,8H,6H2,1-3H3/b5-4+.
What are the key properties of (E)-1,5,5-trimethoxypent-1-en-3-one?
(E)-1,5,5-trimethoxypent-1-en-3-one has a molecular weight of 174.20 g/mol, XLogP of 0.72, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,5,5-trimethoxypent-1-en-3-one is sourced from PubChem (CID 23144803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).