C19H19F3N2O4S — CID 23145538
1-[2-[5-amino-2-(4-methylsulfonylphenoxy)phenyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 23145538) has the molecular formula C19H19F3N2O4S and a molecular weight of 428.43 g/mol. Its IUPAC name is 1-[2-[5-amino-2-(4-methylsulfonylphenoxy)phenyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-[5-amino-2-(4-methylsulfonylphenoxy)phenyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 23145538 |
| Molecular Formula | C19H19F3N2O4S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 1-[2-[5-amino-2-(4-methylsulfonylphenoxy)phenyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(N)cc2C2CCCN2C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F3N2O4S/c1-29(26,27)14-7-5-13(6-8-14)28-17-9-4-12(23)11-15(17)16-3-2-10-24(16)18(25)19(20,21)22/h4-9,11,16H,2-3,10,23H2,1H3 |
| InChIKey | KRAOLHNUUYPXRO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|