About 6-(1,2,4-triazol-1-yl)pyridin-3-ol
6-(1,2,4-triazol-1-yl)pyridin-3-ol (PubChem CID 23145588) has the molecular formula C7H6N4O
and a molecular weight of 162.15 g/mol. Its IUPAC name is 6-(1,2,4-triazol-1-yl)pyridin-3-ol.
Molecular Properties
| Compound Name | 6-(1,2,4-triazol-1-yl)pyridin-3-ol |
| PubChem CID | 23145588 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 6-(1,2,4-triazol-1-yl)pyridin-3-ol |
| SMILES | Oc1ccc(-n2cncn2)nc1 |
| InChI | InChI=1S/C7H6N4O/c12-6-1-2-7(9-3-6)11-5-8-4-10-11/h1-5,12H |
| InChIKey | HWABZXCZOTWYES-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(1,2,4-triazol-1-yl)pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,2,4-triazol-1-yl)pyridin-3-ol?
The IUPAC name of 6-(1,2,4-triazol-1-yl)pyridin-3-ol (CID 23145588) is 6-(1,2,4-triazol-1-yl)pyridin-3-ol.
What is the SMILES notation for 6-(1,2,4-triazol-1-yl)pyridin-3-ol?
The canonical SMILES for 6-(1,2,4-triazol-1-yl)pyridin-3-ol is Oc1ccc(-n2cncn2)nc1.
What is the InChIKey of 6-(1,2,4-triazol-1-yl)pyridin-3-ol?
The InChIKey is HWABZXCZOTWYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O/c12-6-1-2-7(9-3-6)11-5-8-4-10-11/h1-5,12H.
What are the key properties of 6-(1,2,4-triazol-1-yl)pyridin-3-ol?
6-(1,2,4-triazol-1-yl)pyridin-3-ol has a molecular weight of 162.15 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,2,4-triazol-1-yl)pyridin-3-ol is sourced from PubChem (CID 23145588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).