About 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium
2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium (PubChem CID 2314593) has the molecular formula C23H16BrN4+
and a molecular weight of 428.31 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium |
| PubChem CID | 2314593 |
| Molecular Formula | C23H16BrN4+ |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium |
| SMILES | Brc1ccc(-c2n(-c3ccccn3)c3ccccc3[n+]2-c2ccccn2)cc1 |
| InChI | InChI=1S/C23H16BrN4/c24-18-13-11-17(12-14-18)23-27(21-9-3-5-15-25-21)19-7-1-2-8-20(19)28(23)22-10-4-6-16-26-22/h1-16H/q+1 |
| InChIKey | AWCOVZQPOZIBTC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium?
The IUPAC name of 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium (CID 2314593) is 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium.
What is the SMILES notation for 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium?
The canonical SMILES for 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium is Brc1ccc(-c2n(-c3ccccn3)c3ccccc3[n+]2-c2ccccn2)cc1.
What is the InChIKey of 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium?
The InChIKey is AWCOVZQPOZIBTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16BrN4/c24-18-13-11-17(12-14-18)23-27(21-9-3-5-15-25-21)19-7-1-2-8-20(19)28(23)22-10-4-6-16-26-22/h1-16H/q+1.
What are the key properties of 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium?
2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium has a molecular weight of 428.31 g/mol, XLogP of 5.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-1,3-dipyridin-2-ylbenzimidazol-3-ium is sourced from PubChem (CID 2314593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).