C14H18Cl4N2O — CID 23145993
3,5-dichloro-4-[[3-(dimethylamino)pyrrolidin-1-yl]methyl]benzoyl chloride;hydrochloride (PubChem CID 23145993) has the molecular formula C14H18Cl4N2O and a molecular weight of 372.12 g/mol. Its IUPAC name is 3,5-dichloro-4-[[3-(dimethylamino)pyrrolidin-1-yl]methyl]benzoyl chloride;hydrochloride.
| Compound Name | 3,5-dichloro-4-[[3-(dimethylamino)pyrrolidin-1-yl]methyl]benzoyl chloride;hydrochloride |
|---|---|
| PubChem CID | 23145993 |
| Molecular Formula | C14H18Cl4N2O |
| Molecular Weight | 372.12 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 3,5-dichloro-4-[[3-(dimethylamino)pyrrolidin-1-yl]methyl]benzoyl chloride;hydrochloride |
| SMILES | CN(C)C1CCN(Cc2c(Cl)cc(C(=O)Cl)cc2Cl)C1.Cl |
| InChI | InChI=1S/C14H17Cl3N2O.ClH/c1-18(2)10-3-4-19(7-10)8-11-12(15)5-9(14(17)20)6-13(11)16;/h5-6,10H,3-4,7-8H2,1-2H3;1H |
| InChIKey | JPLSUJJRTNYJGB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.12 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|