About CID 23146730
CID 23146730 (PubChem CID 23146730) has the molecular formula C9H12ClO2Si
and a molecular weight of 215.73 g/mol.
Molecular Properties
| Compound Name | CID 23146730 |
| PubChem CID | 23146730 |
| Molecular Formula | C9H12ClO2Si |
| Molecular Weight | 215.73 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | — |
| SMILES | CO[Si](OC)c1ccccc1CCl |
| InChI | InChI=1S/C9H12ClO2Si/c1-11-13(12-2)9-6-4-3-5-8(9)7-10/h3-6H,7H2,1-2H3 |
| InChIKey | QFRVGIGPLSDGGE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.73 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 23146730 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23146730?
The IUPAC name of CID 23146730 (CID 23146730) is not available.
What is the SMILES notation for CID 23146730?
The canonical SMILES for CID 23146730 is CO[Si](OC)c1ccccc1CCl.
What is the InChIKey of CID 23146730?
The InChIKey is QFRVGIGPLSDGGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClO2Si/c1-11-13(12-2)9-6-4-3-5-8(9)7-10/h3-6H,7H2,1-2H3.
What are the key properties of CID 23146730?
CID 23146730 has a molecular weight of 215.73 g/mol, XLogP of 1.41, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23146730 is sourced from PubChem (CID 23146730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).