About 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole
2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole (PubChem CID 23146814) has the molecular formula C45H30N6
and a molecular weight of 654.78 g/mol. Its IUPAC name is 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole.
Molecular Properties
| Compound Name | 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole |
| PubChem CID | 23146814 |
| Molecular Formula | C45H30N6 |
| Molecular Weight | 654.78 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole |
| SMILES | c1ccc(C2(c3cc(C4(c5ccccc5)N=c5ccccc5=N4)cc(C4(c5ccccc5)N=c5ccccc5=N4)c3)N=c3ccccc3=N2)cc1 |
| InChI | InChI=1S/C45H30N6/c1-4-16-31(17-5-1)43(46-37-22-10-11-23-38(37)47-43)34-28-35(44(32-18-6-2-7-19-32)48-39-24-12-13-25-40(39)49-44)30-36(29-34)45(33-20-8-3-9-21-33)50-41-26-14-15-27-42(41)51-45/h1-30H |
| InChIKey | OGOUEPNGJWIUIU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 654.78 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole?
The IUPAC name of 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole (CID 23146814) is 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole.
What is the SMILES notation for 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole?
The canonical SMILES for 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole is c1ccc(C2(c3cc(C4(c5ccccc5)N=c5ccccc5=N4)cc(C4(c5ccccc5)N=c5ccccc5=N4)c3)N=c3ccccc3=N2)cc1.
What is the InChIKey of 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole?
The InChIKey is OGOUEPNGJWIUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H30N6/c1-4-16-31(17-5-1)43(46-37-22-10-11-23-38(37)47-43)34-28-35(44(32-18-6-2-7-19-32)48-39-24-12-13-25-40(39)49-44)30-36(29-34)45(33-20-8-3-9-21-33)50-41-26-14-15-27-42(41)51-45/h1-30H.
What are the key properties of 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole?
2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole has a molecular weight of 654.78 g/mol, XLogP of 5.15, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(2-phenylbenzimidazol-2-yl)phenyl]-2-phenylbenzimidazole is sourced from PubChem (CID 23146814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).