About 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine
2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine (PubChem CID 23146939) has the molecular formula C20H26BrNO4
and a molecular weight of 424.34 g/mol. Its IUPAC name is 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine |
| PubChem CID | 23146939 |
| Molecular Formula | C20H26BrNO4 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine |
| SMILES | COCOc1cc(OCOC)c(-c2ccccc2)c(CCN(C)C)c1Br |
| InChI | InChI=1S/C20H26BrNO4/c1-22(2)11-10-16-19(15-8-6-5-7-9-15)17(25-13-23-3)12-18(20(16)21)26-14-24-4/h5-9,12H,10-11,13-14H2,1-4H3 |
| InChIKey | WYMREUYDAWTTAY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine?
The IUPAC name of 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine (CID 23146939) is 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine is COCOc1cc(OCOC)c(-c2ccccc2)c(CCN(C)C)c1Br.
What is the InChIKey of 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine?
The InChIKey is WYMREUYDAWTTAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26BrNO4/c1-22(2)11-10-16-19(15-8-6-5-7-9-15)17(25-13-23-3)12-18(20(16)21)26-14-24-4/h5-9,12H,10-11,13-14H2,1-4H3.
What are the key properties of 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine?
2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine has a molecular weight of 424.34 g/mol, XLogP of 4.19, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N,N-dimethylethanamine is sourced from PubChem (CID 23146939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).