C26H32N2O7 — CID 23147066
5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-N-(2-hydroxyethyl)-1,3-oxazole-4-carboxamide (PubChem CID 23147066) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is 5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-N-(2-hydroxyethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-N-(2-hydroxyethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23147066 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-N-(2-hydroxyethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCc1c(OCOC)cc(OCOC)c(-c2ccccc2)c1CCc1ocnc1C(=O)NCCO |
| InChI | InChI=1S/C26H32N2O7/c1-4-19-20(10-11-21-25(28-15-33-21)26(30)27-12-13-29)24(18-8-6-5-7-9-18)23(35-17-32-3)14-22(19)34-16-31-2/h5-9,14-15,29H,4,10-13,16-17H2,1-3H3,(H,27,30) |
| InChIKey | YSIPTJKAOXBCLL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|