About methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate
methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate (PubChem CID 23147127) has the molecular formula C20H19NO5
and a molecular weight of 353.37 g/mol. Its IUPAC name is methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate |
| PubChem CID | 23147127 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCc1c(O)cc(O)c(-c2ccccc2)c1Cc1ocnc1C(=O)OC |
| InChI | InChI=1S/C20H19NO5/c1-3-13-14(9-17-19(20(24)25-2)21-11-26-17)18(16(23)10-15(13)22)12-7-5-4-6-8-12/h4-8,10-11,22-23H,3,9H2,1-2H3 |
| InChIKey | MODXDOMSASNTPY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate (CID 23147127) is methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate is CCc1c(O)cc(O)c(-c2ccccc2)c1Cc1ocnc1C(=O)OC.
What is the InChIKey of methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate?
The InChIKey is MODXDOMSASNTPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO5/c1-3-13-14(9-17-19(20(24)25-2)21-11-26-17)18(16(23)10-15(13)22)12-7-5-4-6-8-12/h4-8,10-11,22-23H,3,9H2,1-2H3.
What are the key properties of methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate?
methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate has a molecular weight of 353.37 g/mol, XLogP of 3.69, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2-ethyl-3,5-dihydroxy-6-phenylphenyl)methyl]-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 23147127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).