C27H34N2O8 — CID 23147261
N-(1,3-dihydroxypropan-2-yl)-5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 23147261) has the molecular formula C27H34N2O8 and a molecular weight of 514.58 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23147261 |
| Molecular Formula | C27H34N2O8 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCc1c(OCOC)cc(OCOC)c(-c2ccccc2)c1CCc1ocnc1C(=O)NC(CO)CO |
| InChI | InChI=1S/C27H34N2O8/c1-4-20-21(10-11-22-26(28-15-35-22)27(32)29-19(13-30)14-31)25(18-8-6-5-7-9-18)24(37-17-34-3)12-23(20)36-16-33-2/h5-9,12,15,19,30-31H,4,10-11,13-14,16-17H2,1-3H3,(H,29,32) |
| InChIKey | GMOOFULGJRUYEE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|