C23H27NO6 — CID 23147296
[5-[[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]methyl]-1,3-oxazol-4-yl]methanol (PubChem CID 23147296) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is [5-[[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]methyl]-1,3-oxazol-4-yl]methanol.
| Compound Name | [5-[[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]methyl]-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 23147296 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [5-[[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]methyl]-1,3-oxazol-4-yl]methanol |
| SMILES | CCc1c(OCOC)cc(OCOC)c(-c2ccccc2)c1Cc1ocnc1CO |
| InChI | InChI=1S/C23H27NO6/c1-4-17-18(10-21-19(12-25)24-13-28-21)23(16-8-6-5-7-9-16)22(30-15-27-3)11-20(17)29-14-26-2/h5-9,11,13,25H,4,10,12,14-15H2,1-3H3 |
| InChIKey | FHWJWUXDAQWAJR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|