C9H10N2O — CID 23148202
1,3,4,9a-tetrahydro-1,4-benzodiazepin-2-one (PubChem CID 23148202) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 1,3,4,9a-tetrahydro-1,4-benzodiazepin-2-one.
| Compound Name | 1,3,4,9a-tetrahydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 23148202 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1,3,4,9a-tetrahydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1CNC=C2C=CC=CC2N1 |
| InChI | InChI=1S/C9H10N2O/c12-9-6-10-5-7-3-1-2-4-8(7)11-9/h1-5,8,10H,6H2,(H,11,12) |
| InChIKey | KOVNJPYNWGALSS-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |