C21H44N+ — CID 23148538
1,1-dioctylpiperidin-1-ium (PubChem CID 23148538) has the molecular formula C21H44N+ and a molecular weight of 310.59 g/mol. Its IUPAC name is 1,1-dioctylpiperidin-1-ium.
| Compound Name | 1,1-dioctylpiperidin-1-ium |
|---|---|
| PubChem CID | 23148538 |
| Molecular Formula | C21H44N+ |
| Molecular Weight | 310.59 g/mol |
| Exact Mass | 310.35 |
| IUPAC Name | 1,1-dioctylpiperidin-1-ium |
| SMILES | CCCCCCCC[N+]1(CCCCCCCC)CCCCC1 |
| InChI | InChI=1S/C21H44N/c1-3-5-7-9-11-14-18-22(20-16-13-17-21-22)19-15-12-10-8-6-4-2/h3-21H2,1-2H3/q+1 |
| InChIKey | VOMDLGJFVWMWAT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.59 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|