1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid

C7H16N2O3S — CID 23148552

IUPAC1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid
SMILESCCN1C=CN(C)C1.CS(=O)(=O)O
InChIInChI=1S/C6H12N2.CH4O3S/c1-3-8-5-4-7(2)6-8;1-5(2,3)4/h4-5H,3,6H2,1-2H3;1H3,(H,2,3,4)
InChIKeyRILPVBCCHVYIJF-UHFFFAOYSA-N
MW208.28 g/mol
LogP0.19
Rot. Bonds1

About 1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid

1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid (PubChem CID 23148552) has the molecular formula C7H16N2O3S and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid.

Molecular Properties

Compound Name1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid
PubChem CID23148552
Molecular FormulaC7H16N2O3S
Molecular Weight208.28 g/mol
Exact Mass208.09
IUPAC Name1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid
SMILESCCN1C=CN(C)C1.CS(=O)(=O)O
InChIInChI=1S/C6H12N2.CH4O3S/c1-3-8-5-4-7(2)6-8;1-5(2,3)4/h4-5H,3,6H2,1-2H3;1H3,(H,2,3,4)
InChIKeyRILPVBCCHVYIJF-UHFFFAOYSA-N
XLogP0.19
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.28
LogP ≤ 50.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid?
The IUPAC name of 1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid (CID 23148552) is 1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid.
What is the SMILES notation for 1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid?
The canonical SMILES for 1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid is CCN1C=CN(C)C1.CS(=O)(=O)O.
What is the InChIKey of 1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid?
The InChIKey is RILPVBCCHVYIJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.CH4O3S/c1-3-8-5-4-7(2)6-8;1-5(2,3)4/h4-5H,3,6H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of 1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid?
1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid has a molecular weight of 208.28 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-2H-imidazole;methanesulfonic acid is sourced from PubChem (CID 23148552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).