C5H4F5N3O — CID 23149128
[3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methanol (PubChem CID 23149128) has the molecular formula C5H4F5N3O and a molecular weight of 217.10 g/mol. Its IUPAC name is [3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methanol.
| Compound Name | [3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methanol |
|---|---|
| PubChem CID | 23149128 |
| Molecular Formula | C5H4F5N3O |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | [3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methanol |
| SMILES | OCn1cnc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C5H4F5N3O/c6-4(7,5(8,9)10)3-11-1-13(2-14)12-3/h1,14H,2H2 |
| InChIKey | OWCKUGJIJNMERZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|