C5H3ClF5N3 — CID 23149134
1-(chloromethyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole (PubChem CID 23149134) has the molecular formula C5H3ClF5N3 and a molecular weight of 235.54 g/mol. Its IUPAC name is 1-(chloromethyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole.
| Compound Name | 1-(chloromethyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 23149134 |
| Molecular Formula | C5H3ClF5N3 |
| Molecular Weight | 235.54 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | 1-(chloromethyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole |
| SMILES | FC(F)(F)C(F)(F)c1ncn(CCl)n1 |
| InChI | InChI=1S/C5H3ClF5N3/c6-1-14-2-12-3(13-14)4(7,8)5(9,10)11/h2H,1H2 |
| InChIKey | OSNHFQFPJQPTJP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|