C6H5F5N2O — CID 23149136
[3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methanol (PubChem CID 23149136) has the molecular formula C6H5F5N2O and a molecular weight of 216.11 g/mol. Its IUPAC name is [3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methanol.
| Compound Name | [3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methanol |
|---|---|
| PubChem CID | 23149136 |
| Molecular Formula | C6H5F5N2O |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | [3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methanol |
| SMILES | OCn1ccc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C6H5F5N2O/c7-5(8,6(9,10)11)4-1-2-13(3-14)12-4/h1-2,14H,3H2 |
| InChIKey | PGJACZCZPVUAHG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|