C5H4F5N3 — CID 23149170
1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole (PubChem CID 23149170) has the molecular formula C5H4F5N3 and a molecular weight of 201.10 g/mol. Its IUPAC name is 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole.
| Compound Name | 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 23149170 |
| Molecular Formula | C5H4F5N3 |
| Molecular Weight | 201.10 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole |
| SMILES | Cn1cnc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C5H4F5N3/c1-13-2-11-3(12-13)4(6,7)5(8,9)10/h2H,1H3 |
| InChIKey | JMEYLEPZRSGFDH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.10 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|