C4H2F5N3 — CID 23149177
5-(1,1,2,2,2-pentafluoroethyl)-1H-1,2,4-triazole (PubChem CID 23149177) has the molecular formula C4H2F5N3 and a molecular weight of 187.07 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-1H-1,2,4-triazole.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 23149177 |
| Molecular Formula | C4H2F5N3 |
| Molecular Weight | 187.07 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-1H-1,2,4-triazole |
| SMILES | FC(F)(F)C(F)(F)c1ncn[nH]1 |
| InChI | InChI=1S/C4H2F5N3/c5-3(6,4(7,8)9)2-10-1-11-12-2/h1H,(H,10,11,12) |
| InChIKey | LFTMGYMJRPCARD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.07 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|