C27H44O7 — CID 23149358
(9Z)-4,7,8-trihydroxy-12-[(1E,3E)-6-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-5-methylhexa-1,3-dienyl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 23149358) has the molecular formula C27H44O7 and a molecular weight of 480.64 g/mol. Its IUPAC name is (9Z)-4,7,8-trihydroxy-12-[(1E,3E)-6-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-5-methylhexa-1,3-dienyl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (9Z)-4,7,8-trihydroxy-12-[(1E,3E)-6-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-5-methylhexa-1,3-dienyl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 23149358 |
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (9Z)-4,7,8-trihydroxy-12-[(1E,3E)-6-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-5-methylhexa-1,3-dienyl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | CCC(O)C(C)C1OC1CC(C)/C=C/C=C/C1OC(=O)CC(O)CCC(C)(O)C(O)/C=C\C1C |
| InChI | InChI=1S/C27H44O7/c1-6-21(29)19(4)26-23(34-26)15-17(2)9-7-8-10-22-18(3)11-12-24(30)27(5,32)14-13-20(28)16-25(31)33-22/h7-12,17-24,26,28-30,32H,6,13-16H2,1-5H3/b9-7+,10-8+,12-11- |
| InChIKey | AVOPDDPVUKKKBQ-GTISLEBZSA-N |
| XLogP | 3.06 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|