C34H25F5O5S2 — CID 23149371
1,1,3,3,3-pentafluoro-2-(4-phenylbenzoyl)oxypropane-1-sulfonate;triphenylsulfanium (PubChem CID 23149371) has the molecular formula C34H25F5O5S2 and a molecular weight of 672.69 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(4-phenylbenzoyl)oxypropane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(4-phenylbenzoyl)oxypropane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 23149371 |
| Molecular Formula | C34H25F5O5S2 |
| Molecular Weight | 672.69 g/mol |
| Exact Mass | 672.11 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(4-phenylbenzoyl)oxypropane-1-sulfonate;triphenylsulfanium |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])c1ccc(-c2ccccc2)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C16H11F5O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;17-15(18,19)14(16(20,21)27(23,24)25)26-13(22)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-15H;1-9,14H,(H,23,24,25)/q+1;/p-1 |
| InChIKey | GXHRFNPWGVDGEL-UHFFFAOYSA-M |
| XLogP | 8.36 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.69 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|