About 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid
5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid (PubChem CID 23149374) has the molecular formula C8H9F5O2
and a molecular weight of 232.15 g/mol. Its IUPAC name is 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid.
Molecular Properties
| Compound Name | 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid |
| PubChem CID | 23149374 |
| Molecular Formula | C8H9F5O2 |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid |
| SMILES | CC(C)(CC(=C(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H9F5O2/c1-7(2,6(14)15)3-4(5(9)10)8(11,12)13/h3H2,1-2H3,(H,14,15) |
| InChIKey | WMDHFGUCCPVFCL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid?
The IUPAC name of 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid (CID 23149374) is 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid.
What is the SMILES notation for 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid?
The canonical SMILES for 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid is CC(C)(CC(=C(F)F)C(F)(F)F)C(=O)O.
What is the InChIKey of 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid?
The InChIKey is WMDHFGUCCPVFCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F5O2/c1-7(2,6(14)15)3-4(5(9)10)8(11,12)13/h3H2,1-2H3,(H,14,15).
What are the key properties of 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid?
5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid has a molecular weight of 232.15 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-2,2-dimethyl-4-(trifluoromethyl)pent-4-enoic acid is sourced from PubChem (CID 23149374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).