C23H19F5O5S2 — CID 23149405
2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium (PubChem CID 23149405) has the molecular formula C23H19F5O5S2 and a molecular weight of 534.52 g/mol. Its IUPAC name is 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium.
| Compound Name | 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 23149405 |
| Molecular Formula | C23H19F5O5S2 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium |
| SMILES | CC(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C5H5F5O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2(11)15-3(4(6,7)8)5(9,10)16(12,13)14/h1-15H;3H,1H3,(H,12,13,14)/q+1;/p-1 |
| InChIKey | HMVRQSFVIFIOKG-UHFFFAOYSA-M |
| XLogP | 5.40 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|