2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid

C5H5F5O5S — CID 23149406

IUPAC2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid
SMILESCC(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O
InChIInChI=1S/C5H5F5O5S/c1-2(11)15-3(4(6,7)8)5(9,10)16(12,13)14/h3H,1H3,(H,12,13,14)
InChIKeyXZMDYFDOWYDDGM-UHFFFAOYSA-N
MW272.15 g/mol
LogP0.96
Rot. Bonds3

About 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid

2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 23149406) has the molecular formula C5H5F5O5S and a molecular weight of 272.15 g/mol. Its IUPAC name is 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.

Molecular Properties

Compound Name2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid
PubChem CID23149406
Molecular FormulaC5H5F5O5S
Molecular Weight272.15 g/mol
Exact Mass271.98
IUPAC Name2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid
SMILESCC(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O
InChIInChI=1S/C5H5F5O5S/c1-2(11)15-3(4(6,7)8)5(9,10)16(12,13)14/h3H,1H3,(H,12,13,14)
InChIKeyXZMDYFDOWYDDGM-UHFFFAOYSA-N
XLogP0.96
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.15
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid?
The IUPAC name of 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (CID 23149406) is 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
What is the SMILES notation for 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid?
The canonical SMILES for 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid is CC(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O.
What is the InChIKey of 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid?
The InChIKey is XZMDYFDOWYDDGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F5O5S/c1-2(11)15-3(4(6,7)8)5(9,10)16(12,13)14/h3H,1H3,(H,12,13,14).
What are the key properties of 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid?
2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid has a molecular weight of 272.15 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid is sourced from PubChem (CID 23149406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).