About 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane
3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane (PubChem CID 23149524) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane.
Molecular Properties
| Compound Name | 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane |
| PubChem CID | 23149524 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane |
| SMILES | C=CCC/C(C)=C/COCC1(C)COC1 |
| InChI | InChI=1S/C13H22O2/c1-4-5-6-12(2)7-8-14-9-13(3)10-15-11-13/h4,7H,1,5-6,8-11H2,2-3H3/b12-7+ |
| InChIKey | YGNDHRGPDCQDQQ-KPKJPENVSA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane?
The IUPAC name of 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane (CID 23149524) is 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane.
What is the SMILES notation for 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane?
The canonical SMILES for 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane is C=CCC/C(C)=C/COCC1(C)COC1.
What is the InChIKey of 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane?
The InChIKey is YGNDHRGPDCQDQQ-KPKJPENVSA-N. The full InChI is InChI=1S/C13H22O2/c1-4-5-6-12(2)7-8-14-9-13(3)10-15-11-13/h4,7H,1,5-6,8-11H2,2-3H3/b12-7+.
What are the key properties of 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane?
3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane has a molecular weight of 210.32 g/mol, XLogP of 2.95, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-[[(2E)-3-methylhepta-2,6-dienoxy]methyl]oxetane is sourced from PubChem (CID 23149524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).