About pent-2-ynyl trifluoromethanesulfonate
pent-2-ynyl trifluoromethanesulfonate (PubChem CID 23149712) has the molecular formula C6H7F3O3S
and a molecular weight of 216.18 g/mol. Its IUPAC name is pent-2-ynyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | pent-2-ynyl trifluoromethanesulfonate |
| PubChem CID | 23149712 |
| Molecular Formula | C6H7F3O3S |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | pent-2-ynyl trifluoromethanesulfonate |
| SMILES | CCC#CCOS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H7F3O3S/c1-2-3-4-5-12-13(10,11)6(7,8)9/h2,5H2,1H3 |
| InChIKey | XFRTXGWJEMTESM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze pent-2-ynyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-2-ynyl trifluoromethanesulfonate?
The IUPAC name of pent-2-ynyl trifluoromethanesulfonate (CID 23149712) is pent-2-ynyl trifluoromethanesulfonate.
What is the SMILES notation for pent-2-ynyl trifluoromethanesulfonate?
The canonical SMILES for pent-2-ynyl trifluoromethanesulfonate is CCC#CCOS(=O)(=O)C(F)(F)F.
What is the InChIKey of pent-2-ynyl trifluoromethanesulfonate?
The InChIKey is XFRTXGWJEMTESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3O3S/c1-2-3-4-5-12-13(10,11)6(7,8)9/h2,5H2,1H3.
What are the key properties of pent-2-ynyl trifluoromethanesulfonate?
pent-2-ynyl trifluoromethanesulfonate has a molecular weight of 216.18 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pent-2-ynyl trifluoromethanesulfonate is sourced from PubChem (CID 23149712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).