C20H15N5O2 — CID 2314975
17-(4-methoxyphenyl)-14-methyl-13-oxa-2,9,15,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-imine (PubChem CID 2314975) has the molecular formula C20H15N5O2 and a molecular weight of 357.37 g/mol. Its IUPAC name is 17-(4-methoxyphenyl)-14-methyl-13-oxa-2,9,15,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-imine.
| Compound Name | 17-(4-methoxyphenyl)-14-methyl-13-oxa-2,9,15,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-imine |
|---|---|
| PubChem CID | 2314975 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 17-(4-methoxyphenyl)-14-methyl-13-oxa-2,9,15,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-imine |
| SMILES | [H]/N=c1\oc(C)nc2c1c1nc3ccccc3nc1n2-c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H15N5O2/c1-11-22-19-16(18(21)27-11)17-20(24-15-6-4-3-5-14(15)23-17)25(19)12-7-9-13(26-2)10-8-12/h3-10,21H,1-2H3/b21-18- |
| InChIKey | KTCLNXMGRDGQLU-UZYVYHOESA-N |
| XLogP | 3.51 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |