C29H14F8N2O3 — CID 2314987
3-hydroxy-4-[[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]iminomethyl]-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 2314987) has the molecular formula C29H14F8N2O3 and a molecular weight of 590.43 g/mol. Its IUPAC name is 3-hydroxy-4-[[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]iminomethyl]-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 3-hydroxy-4-[[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]iminomethyl]-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 2314987 |
| Molecular Formula | C29H14F8N2O3 |
| Molecular Weight | 590.43 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | 3-hydroxy-4-[[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]iminomethyl]-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/c2ccc(Oc3c(F)c(F)c(F)c(F)c3F)cc2)c(O)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C29H14F8N2O3/c30-21-22(31)24(33)26(25(34)23(21)32)42-15-11-9-14(10-12-15)38-13-18-16-5-1-2-6-17(16)27(40)39(28(18)41)20-8-4-3-7-19(20)29(35,36)37/h1-13,41H/b38-13+ |
| InChIKey | YLYZRQFUJAZDMJ-ORYDSYBTSA-N |
| XLogP | 7.95 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.43 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|