About 1-anilinooxypropan-2-one
1-anilinooxypropan-2-one (PubChem CID 23150410) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 1-anilinooxypropan-2-one.
Molecular Properties
| Compound Name | 1-anilinooxypropan-2-one |
| PubChem CID | 23150410 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 1-anilinooxypropan-2-one |
| SMILES | CC(=O)CONc1ccccc1 |
| InChI | InChI=1S/C9H11NO2/c1-8(11)7-12-10-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3 |
| InChIKey | XSCZEHLRSPXACT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-anilinooxypropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anilinooxypropan-2-one?
The IUPAC name of 1-anilinooxypropan-2-one (CID 23150410) is 1-anilinooxypropan-2-one.
What is the SMILES notation for 1-anilinooxypropan-2-one?
The canonical SMILES for 1-anilinooxypropan-2-one is CC(=O)CONc1ccccc1.
What is the InChIKey of 1-anilinooxypropan-2-one?
The InChIKey is XSCZEHLRSPXACT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-8(11)7-12-10-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3.
What are the key properties of 1-anilinooxypropan-2-one?
1-anilinooxypropan-2-one has a molecular weight of 165.19 g/mol, XLogP of 1.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anilinooxypropan-2-one is sourced from PubChem (CID 23150410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).