About 2-anilinooxy-2,3-dihydroinden-1-one
2-anilinooxy-2,3-dihydroinden-1-one (PubChem CID 23150433) has the molecular formula C15H13NO2
and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-anilinooxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 2-anilinooxy-2,3-dihydroinden-1-one |
| PubChem CID | 23150433 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-anilinooxy-2,3-dihydroinden-1-one |
| SMILES | O=C1c2ccccc2CC1ONc1ccccc1 |
| InChI | InChI=1S/C15H13NO2/c17-15-13-9-5-4-6-11(13)10-14(15)18-16-12-7-2-1-3-8-12/h1-9,14,16H,10H2 |
| InChIKey | SGGJZIZYQXJISU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-anilinooxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinooxy-2,3-dihydroinden-1-one?
The IUPAC name of 2-anilinooxy-2,3-dihydroinden-1-one (CID 23150433) is 2-anilinooxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 2-anilinooxy-2,3-dihydroinden-1-one?
The canonical SMILES for 2-anilinooxy-2,3-dihydroinden-1-one is O=C1c2ccccc2CC1ONc1ccccc1.
What is the InChIKey of 2-anilinooxy-2,3-dihydroinden-1-one?
The InChIKey is SGGJZIZYQXJISU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2/c17-15-13-9-5-4-6-11(13)10-14(15)18-16-12-7-2-1-3-8-12/h1-9,14,16H,10H2.
What are the key properties of 2-anilinooxy-2,3-dihydroinden-1-one?
2-anilinooxy-2,3-dihydroinden-1-one has a molecular weight of 239.27 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinooxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 23150433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).