About 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene
2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene (PubChem CID 23150767) has the molecular formula C12H16FIO
and a molecular weight of 322.16 g/mol. Its IUPAC name is 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene |
| PubChem CID | 23150767 |
| Molecular Formula | C12H16FIO |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene |
| SMILES | FC1=CCC(/C=C/COCCCI)C=C1 |
| InChI | InChI=1S/C12H16FIO/c13-12-6-4-11(5-7-12)3-1-9-15-10-2-8-14/h1,3-4,6-7,11H,2,5,8-10H2/b3-1+ |
| InChIKey | WTTDZTTZKZHTSY-HNQUOIGGSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene?
The IUPAC name of 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene (CID 23150767) is 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene.
What is the SMILES notation for 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene?
The canonical SMILES for 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene is FC1=CCC(/C=C/COCCCI)C=C1.
What is the InChIKey of 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene?
The InChIKey is WTTDZTTZKZHTSY-HNQUOIGGSA-N. The full InChI is InChI=1S/C12H16FIO/c13-12-6-4-11(5-7-12)3-1-9-15-10-2-8-14/h1,3-4,6-7,11H,2,5,8-10H2/b3-1+.
What are the key properties of 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene?
2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene has a molecular weight of 322.16 g/mol, XLogP of 3.81, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-[(E)-3-(3-iodopropoxy)prop-1-enyl]cyclohexa-1,3-diene is sourced from PubChem (CID 23150767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).